![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Ultrasonography_small.doc | 07-Aug-2009 13:31 | 25K | |
| Microbiol_biotechnology.doc | 07-Aug-2009 13:57 | 27K | |
| Labdiagn_infectious_dis.doc | 07-Aug-2009 13:59 | 25K | |
| Companion_Diet_06.15.2009.doc | 10-Aug-2009 08:34 | 38K | |
| Human_Diet_Temat_FSGy_06.15.2009.doc | 10-Aug-2009 08:35 | 44K | |
| GRÜNLANDWIRTSCHAFT.doc | 10-Sep-2009 12:20 | 30K | |
| MYKOLOGIE.doc | 10-Sep-2009 12:20 | 30K | |
| MYCOLOGY.doc | 10-Sep-2009 12:21 | 28K | |
| Zellbiologie.doc | 10-Sep-2009 12:22 | 30K | |
| Human Anatomy general.doc | 10-Sep-2009 12:23 | 26K | |
| Physiological Bases of Cardiology syllabus.doc | 10-Sep-2009 12:24 | 25K | |
| Wildlife.doc | 10-Sep-2009 12:26 | 24K | |
| Veterinary nuclear medicine syllabus.doc | 10-Sep-2009 12:27 | 27K | |
| Molecular Cell Physiology syllabus.doc | 10-Sep-2009 12:28 | 25K | |
| History.doc | 10-Sep-2009 12:29 | 39K | |
| Assisted_Repro.doc | 10-Sep-2009 12:30 | 27K | |
| The horse in the farriers view.doc | 10-Sep-2009 12:36 | 24K | |
| optechn_cadarv_info.doc | 05-Feb-2010 15:59 | 23K | |
| Stem Cells syllabus.doc | 23-Jan-2011 17:04 | 61K | |